C9H16N2O2 — CID 79906061
2,6-dioxaspiro[4.5]decane-9-carboximidamide (PubChem CID 79906061) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 2,6-dioxaspiro[4.5]decane-9-carboximidamide.
| Compound Name | 2,6-dioxaspiro[4.5]decane-9-carboximidamide |
|---|---|
| PubChem CID | 79906061 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 2,6-dioxaspiro[4.5]decane-9-carboximidamide |
| SMILES | [H]/N=C(\N)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C9H16N2O2/c10-8(11)7-1-3-13-9(5-7)2-4-12-6-9/h7H,1-6H2,(H3,10,11) |
| InChIKey | WPJOWKPDMYPVIM-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 68.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|