C16H22ClNO3 — CID 79907143
6-chloro-N-(2,2,5,5-tetramethyloxolan-3-yl)-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 79907143) has the molecular formula C16H22ClNO3 and a molecular weight of 311.81 g/mol. Its IUPAC name is 6-chloro-N-(2,2,5,5-tetramethyloxolan-3-yl)-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-chloro-N-(2,2,5,5-tetramethyloxolan-3-yl)-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 79907143 |
| Molecular Formula | C16H22ClNO3 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 6-chloro-N-(2,2,5,5-tetramethyloxolan-3-yl)-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | CC1(C)CC(Nc2cc3c(cc2Cl)OCCO3)C(C)(C)O1 |
| InChI | InChI=1S/C16H22ClNO3/c1-15(2)9-14(16(3,4)21-15)18-11-8-13-12(7-10(11)17)19-5-6-20-13/h7-8,14,18H,5-6,9H2,1-4H3 |
| InChIKey | ZVPZOGAZSKTJEB-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|