C14H19N5 — CID 79907395
3-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2,3,4,5-tetrahydro-1,4-benzodiazepine (PubChem CID 79907395) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is 3-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2,3,4,5-tetrahydro-1,4-benzodiazepine.
| Compound Name | 3-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2,3,4,5-tetrahydro-1,4-benzodiazepine |
|---|---|
| PubChem CID | 79907395 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 3-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-2,3,4,5-tetrahydro-1,4-benzodiazepine |
| SMILES | CC1CN(Cc2ncnn2C)c2ccccc2CN1 |
| InChI | InChI=1S/C14H19N5/c1-11-8-19(9-14-16-10-17-18(14)2)13-6-4-3-5-12(13)7-15-11/h3-6,10-11,15H,7-9H2,1-2H3 |
| InChIKey | TZJUTPYDSFYLHB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |