C15H20N2O2 — CID 79907697
1-butan-2-yl-3-ethyl-3,4-dihydro-1,4-benzodiazepine-2,5-dione (PubChem CID 79907697) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 1-butan-2-yl-3-ethyl-3,4-dihydro-1,4-benzodiazepine-2,5-dione.
| Compound Name | 1-butan-2-yl-3-ethyl-3,4-dihydro-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 79907697 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 1-butan-2-yl-3-ethyl-3,4-dihydro-1,4-benzodiazepine-2,5-dione |
| SMILES | CCC1NC(=O)c2ccccc2N(C(C)CC)C1=O |
| InChI | InChI=1S/C15H20N2O2/c1-4-10(3)17-13-9-7-6-8-11(13)14(18)16-12(5-2)15(17)19/h6-10,12H,4-5H2,1-3H3,(H,16,18) |
| InChIKey | DSAMZZORAACABO-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |