C14H20N2 — CID 79907716
3,3-dimethyl-1-prop-2-enyl-4,5-dihydro-2H-1,4-benzodiazepine (PubChem CID 79907716) has the molecular formula C14H20N2 and a molecular weight of 216.33 g/mol. Its IUPAC name is 3,3-dimethyl-1-prop-2-enyl-4,5-dihydro-2H-1,4-benzodiazepine.
| Compound Name | 3,3-dimethyl-1-prop-2-enyl-4,5-dihydro-2H-1,4-benzodiazepine |
|---|---|
| PubChem CID | 79907716 |
| Molecular Formula | C14H20N2 |
| Molecular Weight | 216.33 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 3,3-dimethyl-1-prop-2-enyl-4,5-dihydro-2H-1,4-benzodiazepine |
| SMILES | C=CCN1CC(C)(C)NCc2ccccc21 |
| InChI | InChI=1S/C14H20N2/c1-4-9-16-11-14(2,3)15-10-12-7-5-6-8-13(12)16/h4-8,15H,1,9-11H2,2-3H3 |
| InChIKey | VQOFGAGAFLABPB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.33 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|