C17H28O3S — CID 79907917
3-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)cyclohexane-1-carboxylic acid (PubChem CID 79907917) has the molecular formula C17H28O3S and a molecular weight of 312.48 g/mol. Its IUPAC name is 3-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)cyclohexane-1-carboxylic acid.
| Compound Name | 3-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 79907917 |
| Molecular Formula | C17H28O3S |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 3-methyl-1-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)cyclohexane-1-carboxylic acid |
| SMILES | CC1CCCC(C(=O)O)(C2CCOC3(CCSCC3)C2)C1 |
| InChI | InChI=1S/C17H28O3S/c1-13-3-2-5-17(11-13,15(18)19)14-4-8-20-16(12-14)6-9-21-10-7-16/h13-14H,2-12H2,1H3,(H,18,19) |
| InChIKey | HALIFIQQTYZTHB-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |