C17H24N2O2 — CID 79909055
1,3-bis(2-methylpropyl)-3,4-dihydro-1,4-benzodiazepine-2,5-dione (PubChem CID 79909055) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 1,3-bis(2-methylpropyl)-3,4-dihydro-1,4-benzodiazepine-2,5-dione.
| Compound Name | 1,3-bis(2-methylpropyl)-3,4-dihydro-1,4-benzodiazepine-2,5-dione |
|---|---|
| PubChem CID | 79909055 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1,3-bis(2-methylpropyl)-3,4-dihydro-1,4-benzodiazepine-2,5-dione |
| SMILES | CC(C)CC1NC(=O)c2ccccc2N(CC(C)C)C1=O |
| InChI | InChI=1S/C17H24N2O2/c1-11(2)9-14-17(21)19(10-12(3)4)15-8-6-5-7-13(15)16(20)18-14/h5-8,11-12,14H,9-10H2,1-4H3,(H,18,20) |
| InChIKey | INKGVUARDQUXRW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |