C16H21ClFNOS — CID 79909221
(2-chloro-4-fluorophenyl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine (PubChem CID 79909221) has the molecular formula C16H21ClFNOS and a molecular weight of 329.87 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine.
| Compound Name | (2-chloro-4-fluorophenyl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine |
|---|---|
| PubChem CID | 79909221 |
| Molecular Formula | C16H21ClFNOS |
| Molecular Weight | 329.87 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (2-chloro-4-fluorophenyl)-(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methanamine |
| SMILES | NC(c1ccc(F)cc1Cl)C1CCOC2(CCSCC2)C1 |
| InChI | InChI=1S/C16H21ClFNOS/c17-14-9-12(18)1-2-13(14)15(19)11-3-6-20-16(10-11)4-7-21-8-5-16/h1-2,9,11,15H,3-8,10,19H2 |
| InChIKey | CYRWCSTZGOEHEX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.87 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |