C19H25NO — CID 79911054
2,2,5,5-tetramethyl-N-(naphthalen-1-ylmethyl)oxolan-3-amine (PubChem CID 79911054) has the molecular formula C19H25NO and a molecular weight of 283.41 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-(naphthalen-1-ylmethyl)oxolan-3-amine.
| Compound Name | 2,2,5,5-tetramethyl-N-(naphthalen-1-ylmethyl)oxolan-3-amine |
|---|---|
| PubChem CID | 79911054 |
| Molecular Formula | C19H25NO |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.19 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-(naphthalen-1-ylmethyl)oxolan-3-amine |
| SMILES | CC1(C)CC(NCc2cccc3ccccc23)C(C)(C)O1 |
| InChI | InChI=1S/C19H25NO/c1-18(2)12-17(19(3,4)21-18)20-13-15-10-7-9-14-8-5-6-11-16(14)15/h5-11,17,20H,12-13H2,1-4H3 |
| InChIKey | MUGOOURIJLBZBM-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |