C18H16ClN3O5 — CID 7991192
2-(4-chloro-2-nitrophenoxy)-1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]ethanone (PubChem CID 7991192) has the molecular formula C18H16ClN3O5 and a molecular weight of 389.80 g/mol. Its IUPAC name is 2-(4-chloro-2-nitrophenoxy)-1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]ethanone.
| Compound Name | 2-(4-chloro-2-nitrophenoxy)-1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]ethanone |
|---|---|
| PubChem CID | 7991192 |
| Molecular Formula | C18H16ClN3O5 |
| Molecular Weight | 389.80 g/mol |
| Exact Mass | 389.08 |
| IUPAC Name | 2-(4-chloro-2-nitrophenoxy)-1-[2,5-dimethyl-1-(5-methyl-1,2-oxazol-3-yl)pyrrol-3-yl]ethanone |
| SMILES | Cc1cc(-n2c(C)cc(C(=O)COc3ccc(Cl)cc3[N+](=O)[O-])c2C)no1 |
| InChI | InChI=1S/C18H16ClN3O5/c1-10-6-14(12(3)21(10)18-7-11(2)27-20-18)16(23)9-26-17-5-4-13(19)8-15(17)22(24)25/h4-8H,9H2,1-3H3 |
| InChIKey | BNGMGVJUGBENEP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 100.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.80 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|