C16H34N2O3 — CID 79911929
3-(aminomethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)-2,2,5,5-tetramethyloxolan-3-amine (PubChem CID 79911929) has the molecular formula C16H34N2O3 and a molecular weight of 302.46 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)-2,2,5,5-tetramethyloxolan-3-amine.
| Compound Name | 3-(aminomethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)-2,2,5,5-tetramethyloxolan-3-amine |
|---|---|
| PubChem CID | 79911929 |
| Molecular Formula | C16H34N2O3 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.26 |
| IUPAC Name | 3-(aminomethyl)-N-(2-methoxyethyl)-N-(3-methoxypropyl)-2,2,5,5-tetramethyloxolan-3-amine |
| SMILES | COCCCN(CCOC)C1(CN)CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C16H34N2O3/c1-14(2)12-16(13-17,15(3,4)21-14)18(9-11-20-6)8-7-10-19-5/h7-13,17H2,1-6H3 |
| InChIKey | GOJSVXXDMGMKPI-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|