C14H25NO2 — CID 79912406
1-(1,9-dioxaspiro[5.5]undecan-4-yl)cyclopentan-1-amine (PubChem CID 79912406) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)cyclopentan-1-amine.
| Compound Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)cyclopentan-1-amine |
|---|---|
| PubChem CID | 79912406 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)cyclopentan-1-amine |
| SMILES | NC1(C2CCOC3(CCOCC3)C2)CCCC1 |
| InChI | InChI=1S/C14H25NO2/c15-14(4-1-2-5-14)12-3-8-17-13(11-12)6-9-16-10-7-13/h12H,1-11,15H2 |
| InChIKey | IBPMHKZZYHAOMZ-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |