C15H29F3N2O — CID 79912655
N,2,2,5,5-pentamethyl-4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine (PubChem CID 79912655) has the molecular formula C15H29F3N2O and a molecular weight of 310.40 g/mol. Its IUPAC name is N,2,2,5,5-pentamethyl-4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine.
| Compound Name | N,2,2,5,5-pentamethyl-4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 79912655 |
| Molecular Formula | C15H29F3N2O |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.22 |
| IUPAC Name | N,2,2,5,5-pentamethyl-4-[[propan-2-yl(2,2,2-trifluoroethyl)amino]methyl]oxolan-3-amine |
| SMILES | CNC1C(CN(CC(F)(F)F)C(C)C)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C15H29F3N2O/c1-10(2)20(9-15(16,17)18)8-11-12(19-7)14(5,6)21-13(11,3)4/h10-12,19H,8-9H2,1-7H3 |
| InChIKey | USAOWVIIGPQTDB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |