C14H20N2O — CID 79914138
5-oxaspiro[3.5]nonan-8-yl(pyridin-4-yl)methanamine (PubChem CID 79914138) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is 5-oxaspiro[3.5]nonan-8-yl(pyridin-4-yl)methanamine.
| Compound Name | 5-oxaspiro[3.5]nonan-8-yl(pyridin-4-yl)methanamine |
|---|---|
| PubChem CID | 79914138 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | 5-oxaspiro[3.5]nonan-8-yl(pyridin-4-yl)methanamine |
| SMILES | NC(c1ccncc1)C1CCOC2(CCC2)C1 |
| InChI | InChI=1S/C14H20N2O/c15-13(11-2-7-16-8-3-11)12-4-9-17-14(10-12)5-1-6-14/h2-3,7-8,12-13H,1,4-6,9-10,15H2 |
| InChIKey | LFKLDTAXKUMPQD-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |