C16H19BrN2O2 — CID 79914587
2-(4-bromo-2,6-dimethylphenyl)-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione (PubChem CID 79914587) has the molecular formula C16H19BrN2O2 and a molecular weight of 351.24 g/mol. Its IUPAC name is 2-(4-bromo-2,6-dimethylphenyl)-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione.
| Compound Name | 2-(4-bromo-2,6-dimethylphenyl)-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 79914587 |
| Molecular Formula | C16H19BrN2O2 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 2-(4-bromo-2,6-dimethylphenyl)-3,6,7,8,9,9a-hexahydropyrido[1,2-a]pyrazine-1,4-dione |
| SMILES | Cc1cc(Br)cc(C)c1N1CC(=O)N2CCCCC2C1=O |
| InChI | InChI=1S/C16H19BrN2O2/c1-10-7-12(17)8-11(2)15(10)19-9-14(20)18-6-4-3-5-13(18)16(19)21/h7-8,13H,3-6,9H2,1-2H3 |
| InChIKey | HVPCLZAOHKYTEQ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |