C18H18FNO4 — CID 7991598
[(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 3-fluoro-4-methoxybenzoate (PubChem CID 7991598) has the molecular formula C18H18FNO4 and a molecular weight of 331.34 g/mol. Its IUPAC name is [(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 3-fluoro-4-methoxybenzoate.
| Compound Name | [(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 3-fluoro-4-methoxybenzoate |
|---|---|
| PubChem CID | 7991598 |
| Molecular Formula | C18H18FNO4 |
| Molecular Weight | 331.34 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | [(2S)-1-(4-methylanilino)-1-oxopropan-2-yl] 3-fluoro-4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)O[C@@H](C)C(=O)Nc2ccc(C)cc2)cc1F |
| InChI | InChI=1S/C18H18FNO4/c1-11-4-7-14(8-5-11)20-17(21)12(2)24-18(22)13-6-9-16(23-3)15(19)10-13/h4-10,12H,1-3H3,(H,20,21)/t12-/m0/s1 |
| InChIKey | HVMDWZNVDIHDEK-LBPRGKRZSA-N |
| XLogP | 3.33 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |