C14H15N3O — CID 79916312
4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pyrimidin-5-amine (PubChem CID 79916312) has the molecular formula C14H15N3O and a molecular weight of 241.29 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pyrimidin-5-amine.
| Compound Name | 4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pyrimidin-5-amine |
|---|---|
| PubChem CID | 79916312 |
| Molecular Formula | C14H15N3O |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 4-(5,6,7,8-tetrahydronaphthalen-2-yloxy)pyrimidin-5-amine |
| SMILES | Nc1cncnc1Oc1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C14H15N3O/c15-13-8-16-9-17-14(13)18-12-6-5-10-3-1-2-4-11(10)7-12/h5-9H,1-4,15H2 |
| InChIKey | ARXXSZKHULQLII-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |