C15H31NO2 — CID 79917065
2,2,5,5-tetramethyl-N-[3-(2-methylpropoxy)propyl]oxolan-3-amine (PubChem CID 79917065) has the molecular formula C15H31NO2 and a molecular weight of 257.42 g/mol. Its IUPAC name is 2,2,5,5-tetramethyl-N-[3-(2-methylpropoxy)propyl]oxolan-3-amine.
| Compound Name | 2,2,5,5-tetramethyl-N-[3-(2-methylpropoxy)propyl]oxolan-3-amine |
|---|---|
| PubChem CID | 79917065 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 2,2,5,5-tetramethyl-N-[3-(2-methylpropoxy)propyl]oxolan-3-amine |
| SMILES | CC(C)COCCCNC1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C15H31NO2/c1-12(2)11-17-9-7-8-16-13-10-14(3,4)18-15(13,5)6/h12-13,16H,7-11H2,1-6H3 |
| InChIKey | UKMCPZKBKSTURS-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|