C18H26N2 — CID 79917103
2-(2,3-dihydro-1H-inden-5-yl)-3,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepine (PubChem CID 79917103) has the molecular formula C18H26N2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 2-(2,3-dihydro-1H-inden-5-yl)-3,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepine.
| Compound Name | 2-(2,3-dihydro-1H-inden-5-yl)-3,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepine |
|---|---|
| PubChem CID | 79917103 |
| Molecular Formula | C18H26N2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.21 |
| IUPAC Name | 2-(2,3-dihydro-1H-inden-5-yl)-3,4,5,7,8,9,10,10a-octahydro-1H-pyrido[1,2-a][1,4]diazepine |
| SMILES | c1cc2c(cc1N1CCCN3CCCCC3C1)CCC2 |
| InChI | InChI=1S/C18H26N2/c1-2-10-19-11-4-12-20(14-18(19)7-1)17-9-8-15-5-3-6-16(15)13-17/h8-9,13,18H,1-7,10-12,14H2 |
| InChIKey | PECUSDRLTHXMGY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|