C10H7F3N4 — CID 79917364
4-N-(3,4,5-trifluorophenyl)pyrimidine-4,5-diamine (PubChem CID 79917364) has the molecular formula C10H7F3N4 and a molecular weight of 240.19 g/mol. Its IUPAC name is 4-N-(3,4,5-trifluorophenyl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(3,4,5-trifluorophenyl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 79917364 |
| Molecular Formula | C10H7F3N4 |
| Molecular Weight | 240.19 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 4-N-(3,4,5-trifluorophenyl)pyrimidine-4,5-diamine |
| SMILES | Nc1cncnc1Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C10H7F3N4/c11-6-1-5(2-7(12)9(6)13)17-10-8(14)3-15-4-16-10/h1-4H,14H2,(H,15,16,17) |
| InChIKey | HKCGRUDRLJCDKJ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.19 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|