About 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrimidine-4,5-diamine
4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrimidine-4,5-diamine (PubChem CID 79917521) has the molecular formula C9H11N5O
and a molecular weight of 205.22 g/mol. Its IUPAC name is 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrimidine-4,5-diamine.
Molecular Properties
| Compound Name | 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrimidine-4,5-diamine |
| PubChem CID | 79917521 |
| Molecular Formula | C9H11N5O |
| Molecular Weight | 205.22 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrimidine-4,5-diamine |
| SMILES | Cc1cc(CNc2ncncc2N)no1 |
| InChI | InChI=1S/C9H11N5O/c1-6-2-7(14-15-6)3-12-9-8(10)4-11-5-13-9/h2,4-5H,3,10H2,1H3,(H,11,12,13) |
| InChIKey | XDAVBEWTBBQBES-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 89.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.22 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrimidine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrimidine-4,5-diamine?
The IUPAC name of 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrimidine-4,5-diamine (CID 79917521) is 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrimidine-4,5-diamine.
What is the SMILES notation for 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrimidine-4,5-diamine?
The canonical SMILES for 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrimidine-4,5-diamine is Cc1cc(CNc2ncncc2N)no1.
What is the InChIKey of 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrimidine-4,5-diamine?
The InChIKey is XDAVBEWTBBQBES-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N5O/c1-6-2-7(14-15-6)3-12-9-8(10)4-11-5-13-9/h2,4-5H,3,10H2,1H3,(H,11,12,13).
What are the key properties of 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrimidine-4,5-diamine?
4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrimidine-4,5-diamine has a molecular weight of 205.22 g/mol, XLogP of 0.97, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[(5-methyl-1,2-oxazol-3-yl)methyl]pyrimidine-4,5-diamine is sourced from PubChem (CID 79917521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).