C9H14N4O2S — CID 79917957
4-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrimidine-4,5-diamine (PubChem CID 79917957) has the molecular formula C9H14N4O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is 4-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrimidine-4,5-diamine.
| Compound Name | 4-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrimidine-4,5-diamine |
|---|---|
| PubChem CID | 79917957 |
| Molecular Formula | C9H14N4O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 4-N-(3-methyl-1,1-dioxothiolan-3-yl)pyrimidine-4,5-diamine |
| SMILES | CC1(Nc2ncncc2N)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H14N4O2S/c1-9(2-3-16(14,15)5-9)13-8-7(10)4-11-6-12-8/h4,6H,2-3,5,10H2,1H3,(H,11,12,13) |
| InChIKey | LFNGXRZFZUGANE-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |