C13H22O4 — CID 79918061
4-(3-ethoxypropanoyl)-2,2,5,5-tetramethyloxolan-3-one (PubChem CID 79918061) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is 4-(3-ethoxypropanoyl)-2,2,5,5-tetramethyloxolan-3-one.
| Compound Name | 4-(3-ethoxypropanoyl)-2,2,5,5-tetramethyloxolan-3-one |
|---|---|
| PubChem CID | 79918061 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | 4-(3-ethoxypropanoyl)-2,2,5,5-tetramethyloxolan-3-one |
| SMILES | CCOCCC(=O)C1C(=O)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C13H22O4/c1-6-16-8-7-9(14)10-11(15)13(4,5)17-12(10,2)3/h10H,6-8H2,1-5H3 |
| InChIKey | TYWCMODDCSPLQY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|