C12H20O4 — CID 79918261
4-(3-methoxypropanoyl)-2,2,5,5-tetramethyloxolan-3-one (PubChem CID 79918261) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-(3-methoxypropanoyl)-2,2,5,5-tetramethyloxolan-3-one.
| Compound Name | 4-(3-methoxypropanoyl)-2,2,5,5-tetramethyloxolan-3-one |
|---|---|
| PubChem CID | 79918261 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-(3-methoxypropanoyl)-2,2,5,5-tetramethyloxolan-3-one |
| SMILES | COCCC(=O)C1C(=O)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C12H20O4/c1-11(2)9(8(13)6-7-15-5)10(14)12(3,4)16-11/h9H,6-7H2,1-5H3 |
| InChIKey | YNFLSFYCMVUNNO-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|