C16H24N4S — CID 79921499
6-methyl-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyridine-3-carbothioamide (PubChem CID 79921499) has the molecular formula C16H24N4S and a molecular weight of 304.46 g/mol. Its IUPAC name is 6-methyl-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyridine-3-carbothioamide.
| Compound Name | 6-methyl-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyridine-3-carbothioamide |
|---|---|
| PubChem CID | 79921499 |
| Molecular Formula | C16H24N4S |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 6-methyl-2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyridine-3-carbothioamide |
| SMILES | Cc1ccc(C(N)=S)c(N2CC3CCCCN3CC2C)n1 |
| InChI | InChI=1S/C16H24N4S/c1-11-6-7-14(15(17)21)16(18-11)20-10-13-5-3-4-8-19(13)9-12(20)2/h6-7,12-13H,3-5,8-10H2,1-2H3,(H2,17,21) |
| InChIKey | ZWTFTLWYHLJISM-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|