C12H17N3O2 — CID 79921982
6-oxaspiro[4.5]decan-9-yl(1H-1,2,4-triazol-5-yl)methanone (PubChem CID 79921982) has the molecular formula C12H17N3O2 and a molecular weight of 235.29 g/mol. Its IUPAC name is 6-oxaspiro[4.5]decan-9-yl(1H-1,2,4-triazol-5-yl)methanone.
| Compound Name | 6-oxaspiro[4.5]decan-9-yl(1H-1,2,4-triazol-5-yl)methanone |
|---|---|
| PubChem CID | 79921982 |
| Molecular Formula | C12H17N3O2 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.13 |
| IUPAC Name | 6-oxaspiro[4.5]decan-9-yl(1H-1,2,4-triazol-5-yl)methanone |
| SMILES | O=C(c1ncn[nH]1)C1CCOC2(CCCC2)C1 |
| InChI | InChI=1S/C12H17N3O2/c16-10(11-13-8-14-15-11)9-3-6-17-12(7-9)4-1-2-5-12/h8-9H,1-7H2,(H,13,14,15) |
| InChIKey | BMMSAFVKPKCXLC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |