About 9-(4-fluorophenyl)sulfonyl-2,6-dioxaspiro[4.5]decane
9-(4-fluorophenyl)sulfonyl-2,6-dioxaspiro[4.5]decane (PubChem CID 79922796) has the molecular formula C14H17FO4S
and a molecular weight of 300.35 g/mol. Its IUPAC name is 9-(4-fluorophenyl)sulfonyl-2,6-dioxaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-(4-fluorophenyl)sulfonyl-2,6-dioxaspiro[4.5]decane |
| PubChem CID | 79922796 |
| Molecular Formula | C14H17FO4S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | 9-(4-fluorophenyl)sulfonyl-2,6-dioxaspiro[4.5]decane |
| SMILES | O=S(=O)(c1ccc(F)cc1)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C14H17FO4S/c15-11-1-3-12(4-2-11)20(16,17)13-5-7-19-14(9-13)6-8-18-10-14/h1-4,13H,5-10H2 |
| InChIKey | ABOKXQCCQHMPTI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-(4-fluorophenyl)sulfonyl-2,6-dioxaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(4-fluorophenyl)sulfonyl-2,6-dioxaspiro[4.5]decane?
The IUPAC name of 9-(4-fluorophenyl)sulfonyl-2,6-dioxaspiro[4.5]decane (CID 79922796) is 9-(4-fluorophenyl)sulfonyl-2,6-dioxaspiro[4.5]decane.
What is the SMILES notation for 9-(4-fluorophenyl)sulfonyl-2,6-dioxaspiro[4.5]decane?
The canonical SMILES for 9-(4-fluorophenyl)sulfonyl-2,6-dioxaspiro[4.5]decane is O=S(=O)(c1ccc(F)cc1)C1CCOC2(CCOC2)C1.
What is the InChIKey of 9-(4-fluorophenyl)sulfonyl-2,6-dioxaspiro[4.5]decane?
The InChIKey is ABOKXQCCQHMPTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17FO4S/c15-11-1-3-12(4-2-11)20(16,17)13-5-7-19-14(9-13)6-8-18-10-14/h1-4,13H,5-10H2.
What are the key properties of 9-(4-fluorophenyl)sulfonyl-2,6-dioxaspiro[4.5]decane?
9-(4-fluorophenyl)sulfonyl-2,6-dioxaspiro[4.5]decane has a molecular weight of 300.35 g/mol, XLogP of 1.94, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(4-fluorophenyl)sulfonyl-2,6-dioxaspiro[4.5]decane is sourced from PubChem (CID 79922796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).