About 9-(3-bromo-4,4-dimethylpentyl)-6-oxa-2-thiaspiro[4.5]decane
9-(3-bromo-4,4-dimethylpentyl)-6-oxa-2-thiaspiro[4.5]decane (PubChem CID 79923800) has the molecular formula C15H27BrOS
and a molecular weight of 335.35 g/mol. Its IUPAC name is 9-(3-bromo-4,4-dimethylpentyl)-6-oxa-2-thiaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-(3-bromo-4,4-dimethylpentyl)-6-oxa-2-thiaspiro[4.5]decane |
| PubChem CID | 79923800 |
| Molecular Formula | C15H27BrOS |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 9-(3-bromo-4,4-dimethylpentyl)-6-oxa-2-thiaspiro[4.5]decane |
| SMILES | CC(C)(C)C(Br)CCC1CCOC2(CCSC2)C1 |
| InChI | InChI=1S/C15H27BrOS/c1-14(2,3)13(16)5-4-12-6-8-17-15(10-12)7-9-18-11-15/h12-13H,4-11H2,1-3H3 |
| InChIKey | QSLVJYJUTRSSIL-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 9-(3-bromo-4,4-dimethylpentyl)-6-oxa-2-thiaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(3-bromo-4,4-dimethylpentyl)-6-oxa-2-thiaspiro[4.5]decane?
The IUPAC name of 9-(3-bromo-4,4-dimethylpentyl)-6-oxa-2-thiaspiro[4.5]decane (CID 79923800) is 9-(3-bromo-4,4-dimethylpentyl)-6-oxa-2-thiaspiro[4.5]decane.
What is the SMILES notation for 9-(3-bromo-4,4-dimethylpentyl)-6-oxa-2-thiaspiro[4.5]decane?
The canonical SMILES for 9-(3-bromo-4,4-dimethylpentyl)-6-oxa-2-thiaspiro[4.5]decane is CC(C)(C)C(Br)CCC1CCOC2(CCSC2)C1.
What is the InChIKey of 9-(3-bromo-4,4-dimethylpentyl)-6-oxa-2-thiaspiro[4.5]decane?
The InChIKey is QSLVJYJUTRSSIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27BrOS/c1-14(2,3)13(16)5-4-12-6-8-17-15(10-12)7-9-18-11-15/h12-13H,4-11H2,1-3H3.
What are the key properties of 9-(3-bromo-4,4-dimethylpentyl)-6-oxa-2-thiaspiro[4.5]decane?
9-(3-bromo-4,4-dimethylpentyl)-6-oxa-2-thiaspiro[4.5]decane has a molecular weight of 335.35 g/mol, XLogP of 4.88, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(3-bromo-4,4-dimethylpentyl)-6-oxa-2-thiaspiro[4.5]decane is sourced from PubChem (CID 79923800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).