C14H29N3O — CID 79924571
2-(ethylamino)-3-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propan-1-ol (PubChem CID 79924571) has the molecular formula C14H29N3O and a molecular weight of 255.41 g/mol. Its IUPAC name is 2-(ethylamino)-3-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propan-1-ol.
| Compound Name | 2-(ethylamino)-3-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 79924571 |
| Molecular Formula | C14H29N3O |
| Molecular Weight | 255.41 g/mol |
| Exact Mass | 255.23 |
| IUPAC Name | 2-(ethylamino)-3-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propan-1-ol |
| SMILES | CCNC(CO)CN1CC2CCCCN2CC1C |
| InChI | InChI=1S/C14H29N3O/c1-3-15-13(11-18)9-17-10-14-6-4-5-7-16(14)8-12(17)2/h12-15,18H,3-11H2,1-2H3 |
| InChIKey | IJWMTWFMZAZIHY-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 38.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.41 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |