C13H27N3O — CID 79924930
1-amino-2-methyl-3-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propan-2-ol (PubChem CID 79924930) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 1-amino-2-methyl-3-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propan-2-ol.
| Compound Name | 1-amino-2-methyl-3-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 79924930 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 1-amino-2-methyl-3-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)propan-2-ol |
| SMILES | CC1CN2CCCCC2CN1CC(C)(O)CN |
| InChI | InChI=1S/C13H27N3O/c1-11-7-15-6-4-3-5-12(15)8-16(11)10-13(2,17)9-14/h11-12,17H,3-10,14H2,1-2H3 |
| InChIKey | HPQUTHNVNUZEMR-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 52.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |