C10H15ClN4S — CID 79925031
3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-4-chloro-1,2,5-thiadiazole (PubChem CID 79925031) has the molecular formula C10H15ClN4S and a molecular weight of 258.78 g/mol. Its IUPAC name is 3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-4-chloro-1,2,5-thiadiazole.
| Compound Name | 3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-4-chloro-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 79925031 |
| Molecular Formula | C10H15ClN4S |
| Molecular Weight | 258.78 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-4-chloro-1,2,5-thiadiazole |
| SMILES | Clc1nsnc1N1CCN2CCCCC2C1 |
| InChI | InChI=1S/C10H15ClN4S/c11-9-10(13-16-12-9)15-6-5-14-4-2-1-3-8(14)7-15/h8H,1-7H2 |
| InChIKey | JDMZYEJZJBEBQE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.78 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |