C15H20Cl2N2 — CID 79925914
2-(2,3-dichlorophenyl)-3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine (PubChem CID 79925914) has the molecular formula C15H20Cl2N2 and a molecular weight of 299.24 g/mol. Its IUPAC name is 2-(2,3-dichlorophenyl)-3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine.
| Compound Name | 2-(2,3-dichlorophenyl)-3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
|---|---|
| PubChem CID | 79925914 |
| Molecular Formula | C15H20Cl2N2 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 2-(2,3-dichlorophenyl)-3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine |
| SMILES | CC1CN2CCCCC2CN1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C15H20Cl2N2/c1-11-9-18-8-3-2-5-12(18)10-19(11)14-7-4-6-13(16)15(14)17/h4,6-7,11-12H,2-3,5,8-10H2,1H3 |
| InChIKey | MBCGFZDXCUUITL-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |