C15H17N3O2S — CID 79926901
3-[(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzenecarbothioamide (PubChem CID 79926901) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 3-[(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzenecarbothioamide.
| Compound Name | 3-[(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzenecarbothioamide |
|---|---|
| PubChem CID | 79926901 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 3-[(1,4-dioxo-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazin-2-yl)methyl]benzenecarbothioamide |
| SMILES | NC(=S)c1cccc(CN2CC(=O)N3CCCC3C2=O)c1 |
| InChI | InChI=1S/C15H17N3O2S/c16-14(21)11-4-1-3-10(7-11)8-17-9-13(19)18-6-2-5-12(18)15(17)20/h1,3-4,7,12H,2,5-6,8-9H2,(H2,16,21) |
| InChIKey | MIDIBKQJWLVUBF-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|