C12H19N3O — CID 79926960
3,3,5,5-tetramethyl-4-oxa-1,7,10-triazatricyclo[6.4.0.02,6]dodeca-2(6),7-diene (PubChem CID 79926960) has the molecular formula C12H19N3O and a molecular weight of 221.30 g/mol. Its IUPAC name is 3,3,5,5-tetramethyl-4-oxa-1,7,10-triazatricyclo[6.4.0.02,6]dodeca-2(6),7-diene.
| Compound Name | 3,3,5,5-tetramethyl-4-oxa-1,7,10-triazatricyclo[6.4.0.02,6]dodeca-2(6),7-diene |
|---|---|
| PubChem CID | 79926960 |
| Molecular Formula | C12H19N3O |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.15 |
| IUPAC Name | 3,3,5,5-tetramethyl-4-oxa-1,7,10-triazatricyclo[6.4.0.02,6]dodeca-2(6),7-diene |
| SMILES | CC1(C)OC(C)(C)c2c1nc1n2CCNC1 |
| InChI | InChI=1S/C12H19N3O/c1-11(2)9-10(12(3,4)16-11)15-6-5-13-7-8(15)14-9/h13H,5-7H2,1-4H3 |
| InChIKey | GHRHBTRLJLWHQI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |