C11H24N2O3S — CID 79927028
3-[(2,2,5,5-tetramethyloxolan-3-yl)amino]propane-1-sulfonamide (PubChem CID 79927028) has the molecular formula C11H24N2O3S and a molecular weight of 264.39 g/mol. Its IUPAC name is 3-[(2,2,5,5-tetramethyloxolan-3-yl)amino]propane-1-sulfonamide.
| Compound Name | 3-[(2,2,5,5-tetramethyloxolan-3-yl)amino]propane-1-sulfonamide |
|---|---|
| PubChem CID | 79927028 |
| Molecular Formula | C11H24N2O3S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 3-[(2,2,5,5-tetramethyloxolan-3-yl)amino]propane-1-sulfonamide |
| SMILES | CC1(C)CC(NCCCS(N)(=O)=O)C(C)(C)O1 |
| InChI | InChI=1S/C11H24N2O3S/c1-10(2)8-9(11(3,4)16-10)13-6-5-7-17(12,14)15/h9,13H,5-8H2,1-4H3,(H2,12,14,15) |
| InChIKey | FLYLJXWQFNJUGQ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|