C14H19ClN6 — CID 79927344
6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-4-chloro-1-methylpyrazolo[5,4-d]pyrimidine (PubChem CID 79927344) has the molecular formula C14H19ClN6 and a molecular weight of 306.80 g/mol. Its IUPAC name is 6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-4-chloro-1-methylpyrazolo[5,4-d]pyrimidine.
| Compound Name | 6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-4-chloro-1-methylpyrazolo[5,4-d]pyrimidine |
|---|---|
| PubChem CID | 79927344 |
| Molecular Formula | C14H19ClN6 |
| Molecular Weight | 306.80 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 6-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylmethyl)-4-chloro-1-methylpyrazolo[5,4-d]pyrimidine |
| SMILES | Cn1ncc2c(Cl)nc(CN3CCN4CCCC4C3)nc21 |
| InChI | InChI=1S/C14H19ClN6/c1-19-14-11(7-16-19)13(15)17-12(18-14)9-20-5-6-21-4-2-3-10(21)8-20/h7,10H,2-6,8-9H2,1H3 |
| InChIKey | XWYRBZGCNZXTFL-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.80 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |