C18H35N3 — CID 79927666
[2-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-propylcyclohexyl]methanamine (PubChem CID 79927666) has the molecular formula C18H35N3 and a molecular weight of 293.50 g/mol. Its IUPAC name is [2-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-propylcyclohexyl]methanamine.
| Compound Name | [2-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-propylcyclohexyl]methanamine |
|---|---|
| PubChem CID | 79927666 |
| Molecular Formula | C18H35N3 |
| Molecular Weight | 293.50 g/mol |
| Exact Mass | 293.28 |
| IUPAC Name | [2-(3-methyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-propylcyclohexyl]methanamine |
| SMILES | CCCC1CCC(CN)C(N2CC3CCCN3CC2C)C1 |
| InChI | InChI=1S/C18H35N3/c1-3-5-15-7-8-16(11-19)18(10-15)21-13-17-6-4-9-20(17)12-14(21)2/h14-18H,3-13,19H2,1-2H3 |
| InChIKey | WDLQRKTZRXDKHP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.50 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |