C12H18O3 — CID 79927740
3-(furan-3-yl)-2,2,5,5-tetramethyloxolan-3-ol (PubChem CID 79927740) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 3-(furan-3-yl)-2,2,5,5-tetramethyloxolan-3-ol.
| Compound Name | 3-(furan-3-yl)-2,2,5,5-tetramethyloxolan-3-ol |
|---|---|
| PubChem CID | 79927740 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 3-(furan-3-yl)-2,2,5,5-tetramethyloxolan-3-ol |
| SMILES | CC1(C)CC(O)(c2ccoc2)C(C)(C)O1 |
| InChI | InChI=1S/C12H18O3/c1-10(2)8-12(13,11(3,4)15-10)9-5-6-14-7-9/h5-7,13H,8H2,1-4H3 |
| InChIKey | NERLGCFJKMOHKK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |