C15H22O2 — CID 79928120
3-benzyl-2,2,5,5-tetramethyloxolan-3-ol (PubChem CID 79928120) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is 3-benzyl-2,2,5,5-tetramethyloxolan-3-ol.
| Compound Name | 3-benzyl-2,2,5,5-tetramethyloxolan-3-ol |
|---|---|
| PubChem CID | 79928120 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | 3-benzyl-2,2,5,5-tetramethyloxolan-3-ol |
| SMILES | CC1(C)CC(O)(Cc2ccccc2)C(C)(C)O1 |
| InChI | InChI=1S/C15H22O2/c1-13(2)11-15(16,14(3,4)17-13)10-12-8-6-5-7-9-12/h5-9,16H,10-11H2,1-4H3 |
| InChIKey | ALBVMZZJTUVMEG-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |