C12H22N2O2 — CID 79928424
3-(2-methoxyethylamino)-2,2,5,5-tetramethyloxolane-3-carbonitrile (PubChem CID 79928424) has the molecular formula C12H22N2O2 and a molecular weight of 226.32 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-2,2,5,5-tetramethyloxolane-3-carbonitrile.
| Compound Name | 3-(2-methoxyethylamino)-2,2,5,5-tetramethyloxolane-3-carbonitrile |
|---|---|
| PubChem CID | 79928424 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 3-(2-methoxyethylamino)-2,2,5,5-tetramethyloxolane-3-carbonitrile |
| SMILES | COCCNC1(C#N)CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C12H22N2O2/c1-10(2)8-12(9-13,11(3,4)16-10)14-6-7-15-5/h14H,6-8H2,1-5H3 |
| InChIKey | BYVKZBIUTHVSFT-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 54.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|