C14H30N2O2 — CID 79928522
3-(aminomethyl)-N-(3-methoxypropyl)-N,2,2,5,5-pentamethyloxolan-3-amine (PubChem CID 79928522) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 3-(aminomethyl)-N-(3-methoxypropyl)-N,2,2,5,5-pentamethyloxolan-3-amine.
| Compound Name | 3-(aminomethyl)-N-(3-methoxypropyl)-N,2,2,5,5-pentamethyloxolan-3-amine |
|---|---|
| PubChem CID | 79928522 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 3-(aminomethyl)-N-(3-methoxypropyl)-N,2,2,5,5-pentamethyloxolan-3-amine |
| SMILES | COCCCN(C)C1(CN)CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C14H30N2O2/c1-12(2)10-14(11-15,13(3,4)18-12)16(5)8-7-9-17-6/h7-11,15H2,1-6H3 |
| InChIKey | ANVGRPGWZKNBBN-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|