C14H24N2OS — CID 79928555
3-(4,5-dimethyl-1,3-thiazol-2-yl)-N,2,2,5,5-pentamethyloxolan-3-amine (PubChem CID 79928555) has the molecular formula C14H24N2OS and a molecular weight of 268.43 g/mol. Its IUPAC name is 3-(4,5-dimethyl-1,3-thiazol-2-yl)-N,2,2,5,5-pentamethyloxolan-3-amine.
| Compound Name | 3-(4,5-dimethyl-1,3-thiazol-2-yl)-N,2,2,5,5-pentamethyloxolan-3-amine |
|---|---|
| PubChem CID | 79928555 |
| Molecular Formula | C14H24N2OS |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 3-(4,5-dimethyl-1,3-thiazol-2-yl)-N,2,2,5,5-pentamethyloxolan-3-amine |
| SMILES | CNC1(c2nc(C)c(C)s2)CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C14H24N2OS/c1-9-10(2)18-11(16-9)14(15-7)8-12(3,4)17-13(14,5)6/h15H,8H2,1-7H3 |
| InChIKey | YKJMNWMRKBTDIE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |