C16H24O3 — CID 79928571
3-[(2-methoxyphenyl)methyl]-2,2,5,5-tetramethyloxolan-3-ol (PubChem CID 79928571) has the molecular formula C16H24O3 and a molecular weight of 264.37 g/mol. Its IUPAC name is 3-[(2-methoxyphenyl)methyl]-2,2,5,5-tetramethyloxolan-3-ol.
| Compound Name | 3-[(2-methoxyphenyl)methyl]-2,2,5,5-tetramethyloxolan-3-ol |
|---|---|
| PubChem CID | 79928571 |
| Molecular Formula | C16H24O3 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.17 |
| IUPAC Name | 3-[(2-methoxyphenyl)methyl]-2,2,5,5-tetramethyloxolan-3-ol |
| SMILES | COc1ccccc1CC1(O)CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C16H24O3/c1-14(2)11-16(17,15(3,4)19-14)10-12-8-6-7-9-13(12)18-5/h6-9,17H,10-11H2,1-5H3 |
| InChIKey | VNFDCFDWJSTQGR-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |