C12H18BrNOS — CID 79929208
5-bromo-N,4-dimethyl-N-pentan-2-ylthiophene-2-carboxamide (PubChem CID 79929208) has the molecular formula C12H18BrNOS and a molecular weight of 304.25 g/mol. Its IUPAC name is 5-bromo-N,4-dimethyl-N-pentan-2-ylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N,4-dimethyl-N-pentan-2-ylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 79929208 |
| Molecular Formula | C12H18BrNOS |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 303.03 |
| IUPAC Name | 5-bromo-N,4-dimethyl-N-pentan-2-ylthiophene-2-carboxamide |
| SMILES | CCCC(C)N(C)C(=O)c1cc(C)c(Br)s1 |
| InChI | InChI=1S/C12H18BrNOS/c1-5-6-9(3)14(4)12(15)10-7-8(2)11(13)16-10/h7,9H,5-6H2,1-4H3 |
| InChIKey | ZHJRSUYFOACOHT-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |