C17H26BrN3 — CID 79929693
N-[[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-bromophenyl]methyl]propan-2-amine (PubChem CID 79929693) has the molecular formula C17H26BrN3 and a molecular weight of 352.32 g/mol. Its IUPAC name is N-[[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-bromophenyl]methyl]propan-2-amine.
| Compound Name | N-[[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-bromophenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 79929693 |
| Molecular Formula | C17H26BrN3 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[[2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl)-4-bromophenyl]methyl]propan-2-amine |
| SMILES | CC(C)NCc1ccc(Br)cc1N1CCN2CCCC2C1 |
| InChI | InChI=1S/C17H26BrN3/c1-13(2)19-11-14-5-6-15(18)10-17(14)21-9-8-20-7-3-4-16(20)12-21/h5-6,10,13,16,19H,3-4,7-9,11-12H2,1-2H3 |
| InChIKey | HBKLTZCWPWVGHJ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |