C5H14N2 — CID 7993
N',N'-dimethylpropane-1,3-diamine (PubChem CID 7993) has the molecular formula C5H14N2 and a molecular weight of 102.18 g/mol. Its IUPAC name is N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 7993 |
| Molecular Formula | C5H14N2 |
| Molecular Weight | 102.18 g/mol |
| Exact Mass | 102.12 |
| IUPAC Name | N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCN |
| InChI | InChI=1S/C5H14N2/c1-7(2)5-3-4-6/h3-6H2,1-2H3 |
| InChIKey | IUNMPGNGSSIWFP-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 102.18 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |