C14H27F3N2O — CID 79930091
N,2,2,5,5-pentamethyl-4-[[methyl(3,3,3-trifluoropropyl)amino]methyl]oxolan-3-amine (PubChem CID 79930091) has the molecular formula C14H27F3N2O and a molecular weight of 296.38 g/mol. Its IUPAC name is N,2,2,5,5-pentamethyl-4-[[methyl(3,3,3-trifluoropropyl)amino]methyl]oxolan-3-amine.
| Compound Name | N,2,2,5,5-pentamethyl-4-[[methyl(3,3,3-trifluoropropyl)amino]methyl]oxolan-3-amine |
|---|---|
| PubChem CID | 79930091 |
| Molecular Formula | C14H27F3N2O |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | N,2,2,5,5-pentamethyl-4-[[methyl(3,3,3-trifluoropropyl)amino]methyl]oxolan-3-amine |
| SMILES | CNC1C(CN(C)CCC(F)(F)F)C(C)(C)OC1(C)C |
| InChI | InChI=1S/C14H27F3N2O/c1-12(2)10(11(18-5)13(3,4)20-12)9-19(6)8-7-14(15,16)17/h10-11,18H,7-9H2,1-6H3 |
| InChIKey | PZLRYMMNXQCAPW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |