C14H22N4 — CID 79930729
2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyridin-4-amine (PubChem CID 79930729) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyridin-4-amine.
| Compound Name | 2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyridin-4-amine |
|---|---|
| PubChem CID | 79930729 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2-(3-methyl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)pyridin-4-amine |
| SMILES | CC1CN2CCCCC2CN1c1cc(N)ccn1 |
| InChI | InChI=1S/C14H22N4/c1-11-9-17-7-3-2-4-13(17)10-18(11)14-8-12(15)5-6-16-14/h5-6,8,11,13H,2-4,7,9-10H2,1H3,(H2,15,16) |
| InChIKey | ADMWZOPIMXUURM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 45.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |