C10H14BrNO2S3 — CID 79930783
4-(5-bromo-4-methylthiophen-2-yl)sulfonyl-1,4-thiazepane (PubChem CID 79930783) has the molecular formula C10H14BrNO2S3 and a molecular weight of 356.33 g/mol. Its IUPAC name is 4-(5-bromo-4-methylthiophen-2-yl)sulfonyl-1,4-thiazepane.
| Compound Name | 4-(5-bromo-4-methylthiophen-2-yl)sulfonyl-1,4-thiazepane |
|---|---|
| PubChem CID | 79930783 |
| Molecular Formula | C10H14BrNO2S3 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 354.94 |
| IUPAC Name | 4-(5-bromo-4-methylthiophen-2-yl)sulfonyl-1,4-thiazepane |
| SMILES | Cc1cc(S(=O)(=O)N2CCCSCC2)sc1Br |
| InChI | InChI=1S/C10H14BrNO2S3/c1-8-7-9(16-10(8)11)17(13,14)12-3-2-5-15-6-4-12/h7H,2-6H2,1H3 |
| InChIKey | QVDIQOPIDAHZJM-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |