C15H26N2O2S — CID 79932128
3-(3-propan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2,3-dihydrothiophene 1,1-dioxide (PubChem CID 79932128) has the molecular formula C15H26N2O2S and a molecular weight of 298.45 g/mol. Its IUPAC name is 3-(3-propan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2,3-dihydrothiophene 1,1-dioxide.
| Compound Name | 3-(3-propan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2,3-dihydrothiophene 1,1-dioxide |
|---|---|
| PubChem CID | 79932128 |
| Molecular Formula | C15H26N2O2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 3-(3-propan-2-yl-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-2,3-dihydrothiophene 1,1-dioxide |
| SMILES | CC(C)C1CN2CCCCC2CN1C1C=CS(=O)(=O)C1 |
| InChI | InChI=1S/C15H26N2O2S/c1-12(2)15-10-16-7-4-3-5-13(16)9-17(15)14-6-8-20(18,19)11-14/h6,8,12-15H,3-5,7,9-11H2,1-2H3 |
| InChIKey | WIPHRPOKPVZVBM-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |